C26H34N6O — CID 155976485
4-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]-5,6,7,8-tetrahydroquinazoline (PubChem CID 155976485) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is 4-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 155976485 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 4-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]-5,6,7,8-tetrahydroquinazoline |
| SMILES | C(#CCN1CCN(c2ccccn2)CC1)COC1CCN(c2ncnc3c2CCCC3)CC1 |
| InChI | InChI=1S/C26H34N6O/c1-2-8-24-23(7-1)26(29-21-28-24)32-14-10-22(11-15-32)33-20-6-5-13-30-16-18-31(19-17-30)25-9-3-4-12-27-25/h3-4,9,12,21-22H,1-2,7-8,10-11,13-20H2 |
| InChIKey | BPDQHKZCPPESRT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|