C22H29N5OS — CID 155976206
4-methyl-2-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]-1,3-thiazole (PubChem CID 155976206) has the molecular formula C22H29N5OS and a molecular weight of 411.58 g/mol. Its IUPAC name is 4-methyl-2-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]-1,3-thiazole.
| Compound Name | 4-methyl-2-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 155976206 |
| Molecular Formula | C22H29N5OS |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 4-methyl-2-[4-[4-(4-pyridin-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]-1,3-thiazole |
| SMILES | Cc1csc(N2CCC(OCC#CCN3CCN(c4ccccn4)CC3)CC2)n1 |
| InChI | InChI=1S/C22H29N5OS/c1-19-18-29-22(24-19)27-11-7-20(8-12-27)28-17-5-4-10-25-13-15-26(16-14-25)21-6-2-3-9-23-21/h2-3,6,9,18,20H,7-8,10-17H2,1H3 |
| InChIKey | DERLLPZWAYJTFI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|