C13H10Cl4O3 — CID 15457856
ethyl (Z)-4,4,4-trichloro-2-(2-chlorobenzoyl)but-2-enoate (PubChem CID 15457856) has the molecular formula C13H10Cl4O3 and a molecular weight of 356.03 g/mol. Its IUPAC name is ethyl (Z)-4,4,4-trichloro-2-(2-chlorobenzoyl)but-2-enoate.
| Compound Name | ethyl (Z)-4,4,4-trichloro-2-(2-chlorobenzoyl)but-2-enoate |
|---|---|
| PubChem CID | 15457856 |
| Molecular Formula | C13H10Cl4O3 |
| Molecular Weight | 356.03 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | ethyl (Z)-4,4,4-trichloro-2-(2-chlorobenzoyl)but-2-enoate |
| SMILES | CCOC(=O)/C(=C\C(Cl)(Cl)Cl)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H10Cl4O3/c1-2-20-12(19)9(7-13(15,16)17)11(18)8-5-3-4-6-10(8)14/h3-7H,2H2,1H3/b9-7- |
| InChIKey | DXWBURVLYQVIFE-CLFYSBASSA-N |
| XLogP | 4.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.03 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|