C21H33N5O3 — CID 154579813
2-(2-methylpropyl)-9-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione (PubChem CID 154579813) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-(2-methylpropyl)-9-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione.
| Compound Name | 2-(2-methylpropyl)-9-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione |
|---|---|
| PubChem CID | 154579813 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 2-(2-methylpropyl)-9-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)N1CCCN2C(=O)CN(CC(C)C)C(=O)C2C1 |
| InChI | InChI=1S/C21H33N5O3/c1-14(2)11-25-13-20(28)26-10-6-9-24(12-18(26)21(25)29)19(27)8-7-17-15(3)22-23(5)16(17)4/h14,18H,6-13H2,1-5H3 |
| InChIKey | WFEGCNRESDGOJQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |