C19H25FN4O3 — CID 154579773
N-(2-fluorophenyl)-2-(2-methylpropyl)-1,4-dioxo-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-9-carboxamide (PubChem CID 154579773) has the molecular formula C19H25FN4O3 and a molecular weight of 376.43 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(2-methylpropyl)-1,4-dioxo-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-9-carboxamide.
| Compound Name | N-(2-fluorophenyl)-2-(2-methylpropyl)-1,4-dioxo-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-9-carboxamide |
|---|---|
| PubChem CID | 154579773 |
| Molecular Formula | C19H25FN4O3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-(2-fluorophenyl)-2-(2-methylpropyl)-1,4-dioxo-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-9-carboxamide |
| SMILES | CC(C)CN1CC(=O)N2CCCN(C(=O)Nc3ccccc3F)CC2C1=O |
| InChI | InChI=1S/C19H25FN4O3/c1-13(2)10-23-12-17(25)24-9-5-8-22(11-16(24)18(23)26)19(27)21-15-7-4-3-6-14(15)20/h3-4,6-7,13,16H,5,8-12H2,1-2H3,(H,21,27) |
| InChIKey | GAJAYGRNPXHXOE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |