C21H30N4O3 — CID 154579807
N-(3,4-dimethylphenyl)-2-(2-methylpropyl)-1,4-dioxo-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-9-carboxamide (PubChem CID 154579807) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-(2-methylpropyl)-1,4-dioxo-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-9-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-(2-methylpropyl)-1,4-dioxo-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-9-carboxamide |
|---|---|
| PubChem CID | 154579807 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-(2-methylpropyl)-1,4-dioxo-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-9-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCCN3C(=O)CN(CC(C)C)C(=O)C3C2)cc1C |
| InChI | InChI=1S/C21H30N4O3/c1-14(2)11-24-13-19(26)25-9-5-8-23(12-18(25)20(24)27)21(28)22-17-7-6-15(3)16(4)10-17/h6-7,10,14,18H,5,8-9,11-13H2,1-4H3,(H,22,28) |
| InChIKey | NEWJUXXYPDYNMF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |