C19H29N3O4S — CID 154579942
9-(2-ethylphenyl)sulfonyl-2-(2-methoxyethyl)-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one (PubChem CID 154579942) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 9-(2-ethylphenyl)sulfonyl-2-(2-methoxyethyl)-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one.
| Compound Name | 9-(2-ethylphenyl)sulfonyl-2-(2-methoxyethyl)-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one |
|---|---|
| PubChem CID | 154579942 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 9-(2-ethylphenyl)sulfonyl-2-(2-methoxyethyl)-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one |
| SMILES | CCc1ccccc1S(=O)(=O)N1CCCN2CCN(CCOC)C(=O)C2C1 |
| InChI | InChI=1S/C19H29N3O4S/c1-3-16-7-4-5-8-18(16)27(24,25)22-10-6-9-20-11-12-21(13-14-26-2)19(23)17(20)15-22/h4-5,7-8,17H,3,6,9-15H2,1-2H3 |
| InChIKey | ITCBGBFLFJGEHY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |