C21H31N3O4S — CID 154579939
2-(2-methoxyethyl)-9-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one (PubChem CID 154579939) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-9-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one.
| Compound Name | 2-(2-methoxyethyl)-9-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one |
|---|---|
| PubChem CID | 154579939 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-(2-methoxyethyl)-9-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-4,6,7,8,10,10a-hexahydro-3H-pyrazino[1,2-a][1,4]diazepin-1-one |
| SMILES | COCCN1CCN2CCCN(S(=O)(=O)c3ccc4c(c3)CCCC4)CC2C1=O |
| InChI | InChI=1S/C21H31N3O4S/c1-28-14-13-23-12-11-22-9-4-10-24(16-20(22)21(23)25)29(26,27)19-8-7-17-5-2-3-6-18(17)15-19/h7-8,15,20H,2-6,9-14,16H2,1H3 |
| InChIKey | RSZPDMTZLZRUKA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |