C23H31N3O4S — CID 154579311
2-cyclohexyl-8-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione (PubChem CID 154579311) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is 2-cyclohexyl-8-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione.
| Compound Name | 2-cyclohexyl-8-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione |
|---|---|
| PubChem CID | 154579311 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-cyclohexyl-8-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-6,7,9,9a-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1,3-dione |
| SMILES | O=C1C2CN(S(=O)(=O)c3ccc4c(c3)CCCC4)CCCN2C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C23H31N3O4S/c27-22-21-16-24(31(29,30)20-12-11-17-7-4-5-8-18(17)15-20)13-6-14-25(21)23(28)26(22)19-9-2-1-3-10-19/h11-12,15,19,21H,1-10,13-14,16H2 |
| InChIKey | FTFQOKAIYMUZCL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|