C13H14F3N5 — CID 154580624
2-[3-[(4-methylpyrazol-1-yl)methyl]azetidin-1-yl]-4-(trifluoromethyl)pyrimidine (PubChem CID 154580624) has the molecular formula C13H14F3N5 and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-[3-[(4-methylpyrazol-1-yl)methyl]azetidin-1-yl]-4-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[3-[(4-methylpyrazol-1-yl)methyl]azetidin-1-yl]-4-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 154580624 |
| Molecular Formula | C13H14F3N5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[3-[(4-methylpyrazol-1-yl)methyl]azetidin-1-yl]-4-(trifluoromethyl)pyrimidine |
| SMILES | Cc1cnn(CC2CN(c3nccc(C(F)(F)F)n3)C2)c1 |
| InChI | InChI=1S/C13H14F3N5/c1-9-4-18-21(5-9)8-10-6-20(7-10)12-17-3-2-11(19-12)13(14,15)16/h2-5,10H,6-8H2,1H3 |
| InChIKey | HGHOANHLXQKQPC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |