C20H24N6O3S — CID 154581577
4-[4-(1-ethyl-2-methylimidazol-4-yl)sulfonylpiperazin-1-yl]-3-phenyl-1H-pyridazin-6-one (PubChem CID 154581577) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is 4-[4-(1-ethyl-2-methylimidazol-4-yl)sulfonylpiperazin-1-yl]-3-phenyl-1H-pyridazin-6-one.
| Compound Name | 4-[4-(1-ethyl-2-methylimidazol-4-yl)sulfonylpiperazin-1-yl]-3-phenyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 154581577 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-[4-(1-ethyl-2-methylimidazol-4-yl)sulfonylpiperazin-1-yl]-3-phenyl-1H-pyridazin-6-one |
| SMILES | CCn1cc(S(=O)(=O)N2CCN(c3cc(=O)[nH]nc3-c3ccccc3)CC2)nc1C |
| InChI | InChI=1S/C20H24N6O3S/c1-3-24-14-19(21-15(24)2)30(28,29)26-11-9-25(10-12-26)17-13-18(27)22-23-20(17)16-7-5-4-6-8-16/h4-8,13-14H,3,9-12H2,1-2H3,(H,22,27) |
| InChIKey | XXELWYANBUFXSA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |