C20H20N6O2 — CID 74240607
4-[4-(2-methylpyrimidine-5-carbonyl)piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one (PubChem CID 74240607) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-[4-(2-methylpyrimidine-5-carbonyl)piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one.
| Compound Name | 4-[4-(2-methylpyrimidine-5-carbonyl)piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 74240607 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-[4-(2-methylpyrimidine-5-carbonyl)piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one |
| SMILES | Cc1ncc(C(=O)N2CCN(c3cc(=O)[nH]nc3-c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C20H20N6O2/c1-14-21-12-16(13-22-14)20(28)26-9-7-25(8-10-26)17-11-18(27)23-24-19(17)15-5-3-2-4-6-15/h2-6,11-13H,7-10H2,1H3,(H,23,27) |
| InChIKey | YSDYZPGNCFHJPW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |