C25H25N5O2 — CID 154581617
4-[4-[2-(1-methylindol-3-yl)acetyl]piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one (PubChem CID 154581617) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 4-[4-[2-(1-methylindol-3-yl)acetyl]piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one.
| Compound Name | 4-[4-[2-(1-methylindol-3-yl)acetyl]piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 154581617 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 4-[4-[2-(1-methylindol-3-yl)acetyl]piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one |
| SMILES | Cn1cc(CC(=O)N2CCN(c3cc(=O)[nH]nc3-c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H25N5O2/c1-28-17-19(20-9-5-6-10-21(20)28)15-24(32)30-13-11-29(12-14-30)22-16-23(31)26-27-25(22)18-7-3-2-4-8-18/h2-10,16-17H,11-15H2,1H3,(H,26,31) |
| InChIKey | XHAFQDYCMKBWQY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |