C19H25N5O2 — CID 70746850
4-[4-[(3-hydroxypyrrolidin-3-yl)methyl]piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one (PubChem CID 70746850) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-[4-[(3-hydroxypyrrolidin-3-yl)methyl]piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one.
| Compound Name | 4-[4-[(3-hydroxypyrrolidin-3-yl)methyl]piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 70746850 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 4-[4-[(3-hydroxypyrrolidin-3-yl)methyl]piperazin-1-yl]-3-phenyl-1H-pyridazin-6-one |
| SMILES | O=c1cc(N2CCN(CC3(O)CCNC3)CC2)c(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H25N5O2/c25-17-12-16(18(22-21-17)15-4-2-1-3-5-15)24-10-8-23(9-11-24)14-19(26)6-7-20-13-19/h1-5,12,20,26H,6-11,13-14H2,(H,21,25) |
| InChIKey | BGICCGYYWUWGEM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |