C19H20ClN3O2 — CID 154581755
2-(4-chlorophenoxy)-1-(5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)ethanone (PubChem CID 154581755) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-(5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)ethanone.
| Compound Name | 2-(4-chlorophenoxy)-1-(5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 154581755 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-(5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1)N1CCC2CN(c3ccccn3)CC21 |
| InChI | InChI=1S/C19H20ClN3O2/c20-15-4-6-16(7-5-15)25-13-19(24)23-10-8-14-11-22(12-17(14)23)18-3-1-2-9-21-18/h1-7,9,14,17H,8,10-13H2 |
| InChIKey | GBGJXJXSUGFIIG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |