C19H27N5O — CID 167996931
2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl-(5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl)methanone (PubChem CID 167996931) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl-(5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl-(5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 167996931 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl-(5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl)methanone |
| SMILES | O=C(C1NNC2CCCCC21)N1CCC2CN(c3ccccn3)CC21 |
| InChI | InChI=1S/C19H27N5O/c25-19(18-14-5-1-2-6-15(14)21-22-18)24-10-8-13-11-23(12-16(13)24)17-7-3-4-9-20-17/h3-4,7,9,13-16,18,21-22H,1-2,5-6,8,10-12H2 |
| InChIKey | RKODIOWOUCFKGB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |