C13H17N5O — CID 154582460
1-(3-methylimidazo[4,5-b]pyridin-2-yl)piperidine-4-carboxamide (PubChem CID 154582460) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-(3-methylimidazo[4,5-b]pyridin-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(3-methylimidazo[4,5-b]pyridin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 154582460 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-(3-methylimidazo[4,5-b]pyridin-2-yl)piperidine-4-carboxamide |
| SMILES | Cn1c(N2CCC(C(N)=O)CC2)nc2cccnc21 |
| InChI | InChI=1S/C13H17N5O/c1-17-12-10(3-2-6-15-12)16-13(17)18-7-4-9(5-8-18)11(14)19/h2-3,6,9H,4-5,7-8H2,1H3,(H2,14,19) |
| InChIKey | OMFSNXBWNFHCKB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |