C17H19FN4O — CID 154582539
1-[1-(7-fluoroquinazolin-4-yl)-2-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]ethanone (PubChem CID 154582539) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is 1-[1-(7-fluoroquinazolin-4-yl)-2-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]ethanone.
| Compound Name | 1-[1-(7-fluoroquinazolin-4-yl)-2-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]ethanone |
|---|---|
| PubChem CID | 154582539 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-[1-(7-fluoroquinazolin-4-yl)-2-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]ethanone |
| SMILES | CC(=O)N1CC2CC(C)N(c3ncnc4cc(F)ccc34)C2C1 |
| InChI | InChI=1S/C17H19FN4O/c1-10-5-12-7-21(11(2)23)8-16(12)22(10)17-14-4-3-13(18)6-15(14)19-9-20-17/h3-4,6,9-10,12,16H,5,7-8H2,1-2H3 |
| InChIKey | WRVYLNDPAIETOT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |