C15H18ClN3O2S2 — CID 154583813
8-(5-chlorothiophen-2-yl)sulfonyl-3-(4-methylpyrazol-1-yl)-8-azabicyclo[3.2.1]octane (PubChem CID 154583813) has the molecular formula C15H18ClN3O2S2 and a molecular weight of 371.92 g/mol. Its IUPAC name is 8-(5-chlorothiophen-2-yl)sulfonyl-3-(4-methylpyrazol-1-yl)-8-azabicyclo[3.2.1]octane.
| Compound Name | 8-(5-chlorothiophen-2-yl)sulfonyl-3-(4-methylpyrazol-1-yl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 154583813 |
| Molecular Formula | C15H18ClN3O2S2 |
| Molecular Weight | 371.92 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 8-(5-chlorothiophen-2-yl)sulfonyl-3-(4-methylpyrazol-1-yl)-8-azabicyclo[3.2.1]octane |
| SMILES | Cc1cnn(C2CC3CCC(C2)N3S(=O)(=O)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C15H18ClN3O2S2/c1-10-8-17-18(9-10)13-6-11-2-3-12(7-13)19(11)23(20,21)15-5-4-14(16)22-15/h4-5,8-9,11-13H,2-3,6-7H2,1H3 |
| InChIKey | ZJCRCLJHIOWBFI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.92 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |