C23H28N6O2S — CID 154584595
N-ethyl-2-[4-[(5-oxo-3,4,4a,6-tetrahydro-2H-benzo[h][1,6]naphthyridin-8-yl)methyl]piperazin-1-yl]-1,3-thiazole-4-carboxamide (PubChem CID 154584595) has the molecular formula C23H28N6O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-ethyl-2-[4-[(5-oxo-3,4,4a,6-tetrahydro-2H-benzo[h][1,6]naphthyridin-8-yl)methyl]piperazin-1-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-ethyl-2-[4-[(5-oxo-3,4,4a,6-tetrahydro-2H-benzo[h][1,6]naphthyridin-8-yl)methyl]piperazin-1-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 154584595 |
| Molecular Formula | C23H28N6O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-ethyl-2-[4-[(5-oxo-3,4,4a,6-tetrahydro-2H-benzo[h][1,6]naphthyridin-8-yl)methyl]piperazin-1-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCNC(=O)c1csc(N2CCN(Cc3ccc4c(c3)NC(=O)C3CCCN=C43)CC2)n1 |
| InChI | InChI=1S/C23H28N6O2S/c1-2-24-22(31)19-14-32-23(27-19)29-10-8-28(9-11-29)13-15-5-6-16-18(12-15)26-21(30)17-4-3-7-25-20(16)17/h5-6,12,14,17H,2-4,7-11,13H2,1H3,(H,24,31)(H,26,30) |
| InChIKey | MBOTZLDFLHDLEL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |