C23H29ClN6O2 — CID 169102604
6-chloro-N-ethyl-5-[4-[(3-ethyl-2-oxo-1,4-dihydroquinazolin-7-yl)methyl]piperazin-1-yl]pyridine-2-carboxamide (PubChem CID 169102604) has the molecular formula C23H29ClN6O2 and a molecular weight of 456.98 g/mol. Its IUPAC name is 6-chloro-N-ethyl-5-[4-[(3-ethyl-2-oxo-1,4-dihydroquinazolin-7-yl)methyl]piperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-ethyl-5-[4-[(3-ethyl-2-oxo-1,4-dihydroquinazolin-7-yl)methyl]piperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169102604 |
| Molecular Formula | C23H29ClN6O2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 6-chloro-N-ethyl-5-[4-[(3-ethyl-2-oxo-1,4-dihydroquinazolin-7-yl)methyl]piperazin-1-yl]pyridine-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(N2CCN(Cc3ccc4c(c3)NC(=O)N(CC)C4)CC2)c(Cl)n1 |
| InChI | InChI=1S/C23H29ClN6O2/c1-3-25-22(31)18-7-8-20(21(24)26-18)30-11-9-28(10-12-30)14-16-5-6-17-15-29(4-2)23(32)27-19(17)13-16/h5-8,13H,3-4,9-12,14-15H2,1-2H3,(H,25,31)(H,27,32) |
| InChIKey | KJVKBNOJEUHTSN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|