C22H21ClF3N5O2 — CID 159964835
6-chloro-N-methyl-5-[4-[[3-oxo-2-(trifluoromethyl)-4H-quinolin-6-yl]methyl]piperazin-1-yl]pyridine-2-carboxamide (PubChem CID 159964835) has the molecular formula C22H21ClF3N5O2 and a molecular weight of 479.89 g/mol. Its IUPAC name is 6-chloro-N-methyl-5-[4-[[3-oxo-2-(trifluoromethyl)-4H-quinolin-6-yl]methyl]piperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-methyl-5-[4-[[3-oxo-2-(trifluoromethyl)-4H-quinolin-6-yl]methyl]piperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 159964835 |
| Molecular Formula | C22H21ClF3N5O2 |
| Molecular Weight | 479.89 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 6-chloro-N-methyl-5-[4-[[3-oxo-2-(trifluoromethyl)-4H-quinolin-6-yl]methyl]piperazin-1-yl]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(Cc3ccc4c(c3)CC(=O)C(C(F)(F)F)=N4)CC2)c(Cl)n1 |
| InChI | InChI=1S/C22H21ClF3N5O2/c1-27-21(33)16-4-5-17(20(23)29-16)31-8-6-30(7-9-31)12-13-2-3-15-14(10-13)11-18(32)19(28-15)22(24,25)26/h2-5,10H,6-9,11-12H2,1H3,(H,27,33) |
| InChIKey | ODUKZMKALUEPPP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.89 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|