C25H40BNO4 — CID 154585587
tert-butyl 3-[(1S)-5-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]azetidine-1-carboxylate (PubChem CID 154585587) has the molecular formula C25H40BNO4 and a molecular weight of 429.41 g/mol. Its IUPAC name is tert-butyl 3-[(1S)-5-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1S)-5-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 154585587 |
| Molecular Formula | C25H40BNO4 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | tert-butyl 3-[(1S)-5-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC([C@H](CCCCc2ccccc2)B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C25H40BNO4/c1-23(2,3)29-22(28)27-17-20(18-27)21(26-30-24(4,5)25(6,7)31-26)16-12-11-15-19-13-9-8-10-14-19/h8-10,13-14,20-21H,11-12,15-18H2,1-7H3/t21-/m0/s1 |
| InChIKey | GEJCSUBKBPZOJV-NRFANRHFSA-N |
| XLogP | 5.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|