C40H49BClNO7 — CID 154585616
[(4S)-9-phenoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (PubChem CID 154585616) has the molecular formula C40H49BClNO7 and a molecular weight of 702.10 g/mol. Its IUPAC name is [(4S)-9-phenoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate.
| Compound Name | [(4S)-9-phenoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 154585616 |
| Molecular Formula | C40H49BClNO7 |
| Molecular Weight | 702.10 g/mol |
| Exact Mass | 701.33 |
| IUPAC Name | [(4S)-9-phenoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| SMILES | COc1ccc2c(c1)c(CC(=O)OCCC[C@H](CCCCCOc1ccccc1)B1OC(C)(C)C(C)(C)O1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C40H49BClNO7/c1-28-34(35-26-33(46-6)22-23-36(35)43(28)38(45)29-18-20-31(42)21-19-29)27-37(44)48-25-13-15-30(41-49-39(2,3)40(4,5)50-41)14-9-8-12-24-47-32-16-10-7-11-17-32/h7,10-11,16-23,26,30H,8-9,12-15,24-25,27H2,1-6H3/t30-/m0/s1 |
| InChIKey | WPJCCQOTULCXHT-PMERELPUSA-N |
| XLogP | 9.27 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.10 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|