C22H29NO2 — CID 15458564
ethyl (2E,4E,6E)-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoate (PubChem CID 15458564) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoate |
|---|---|
| PubChem CID | 15458564 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | ethyl (2E,4E,6E)-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C/C=C/C=C(\C)c1ccc2c(c1)CCCN2C(C)C |
| InChI | InChI=1S/C22H29NO2/c1-5-25-22(24)12-8-6-7-10-18(4)19-13-14-21-20(16-19)11-9-15-23(21)17(2)3/h6-8,10,12-14,16-17H,5,9,11,15H2,1-4H3/b7-6+,12-8+,18-10+ |
| InChIKey | IJVQZZONACHDPL-PAHGCZMJSA-N |
| XLogP | 4.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|