C16H20NO2- — CID 18466796
(E)-3-(1-propan-2-yl-3,4-dihydro-2H-quinolin-7-yl)but-2-enoate (PubChem CID 18466796) has the molecular formula C16H20NO2- and a molecular weight of 258.34 g/mol. Its IUPAC name is (E)-3-(1-propan-2-yl-3,4-dihydro-2H-quinolin-7-yl)but-2-enoate.
| Compound Name | (E)-3-(1-propan-2-yl-3,4-dihydro-2H-quinolin-7-yl)but-2-enoate |
|---|---|
| PubChem CID | 18466796 |
| Molecular Formula | C16H20NO2- |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (E)-3-(1-propan-2-yl-3,4-dihydro-2H-quinolin-7-yl)but-2-enoate |
| SMILES | C/C(=C\C(=O)[O-])c1ccc2c(c1)N(C(C)C)CCC2 |
| InChI | InChI=1S/C16H21NO2/c1-11(2)17-8-4-5-13-6-7-14(10-15(13)17)12(3)9-16(18)19/h6-7,9-11H,4-5,8H2,1-3H3,(H,18,19)/p-1/b12-9+ |
| InChIKey | ZKZKHACCWBGCHO-FMIVXFBMSA-M |
| XLogP | 2.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|