C18H25N2O2- — CID 18466841
(E)-3-[1,4-di(propan-2-yl)-2,3-dihydroquinoxalin-6-yl]but-2-enoate (PubChem CID 18466841) has the molecular formula C18H25N2O2- and a molecular weight of 301.41 g/mol. Its IUPAC name is (E)-3-[1,4-di(propan-2-yl)-2,3-dihydroquinoxalin-6-yl]but-2-enoate.
| Compound Name | (E)-3-[1,4-di(propan-2-yl)-2,3-dihydroquinoxalin-6-yl]but-2-enoate |
|---|---|
| PubChem CID | 18466841 |
| Molecular Formula | C18H25N2O2- |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | (E)-3-[1,4-di(propan-2-yl)-2,3-dihydroquinoxalin-6-yl]but-2-enoate |
| SMILES | C/C(=C\C(=O)[O-])c1ccc2c(c1)N(C(C)C)CCN2C(C)C |
| InChI | InChI=1S/C18H26N2O2/c1-12(2)19-8-9-20(13(3)4)17-11-15(6-7-16(17)19)14(5)10-18(21)22/h6-7,10-13H,8-9H2,1-5H3,(H,21,22)/p-1/b14-10+ |
| InChIKey | YFSPHBABBANZJY-GXDHUFHOSA-M |
| XLogP | 2.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|