C15H19NO2 — CID 70159553
(Z)-3-(1,4-dimethyl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoic acid (PubChem CID 70159553) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (Z)-3-(1,4-dimethyl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoic acid.
| Compound Name | (Z)-3-(1,4-dimethyl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 70159553 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (Z)-3-(1,4-dimethyl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)c1ccc2c(c1)C(C)CCN2C |
| InChI | InChI=1S/C15H19NO2/c1-10-6-7-16(3)14-5-4-12(9-13(10)14)11(2)8-15(17)18/h4-5,8-10H,6-7H2,1-3H3,(H,17,18)/b11-8- |
| InChIKey | BXMCATZDDFTRHI-FLIBITNWSA-N |
| XLogP | 3.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|