C21H25N3O3 — CID 151935726
1-methyl-4-(4-morpholin-4-ylanilino)-3,4-dihydro-2H-quinoline-6-carboxylic acid (PubChem CID 151935726) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-methyl-4-(4-morpholin-4-ylanilino)-3,4-dihydro-2H-quinoline-6-carboxylic acid.
| Compound Name | 1-methyl-4-(4-morpholin-4-ylanilino)-3,4-dihydro-2H-quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 151935726 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-methyl-4-(4-morpholin-4-ylanilino)-3,4-dihydro-2H-quinoline-6-carboxylic acid |
| SMILES | CN1CCC(Nc2ccc(N3CCOCC3)cc2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C21H25N3O3/c1-23-9-8-19(18-14-15(21(25)26)2-7-20(18)23)22-16-3-5-17(6-4-16)24-10-12-27-13-11-24/h2-7,14,19,22H,8-13H2,1H3,(H,25,26) |
| InChIKey | SZTBXPPUCDOSQN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|