C29H38N4O5 — CID 90374048
6-[[1-acetyl-2-methyl-4-(4-morpholin-4-ylanilino)-3,4-dihydro-2H-quinoline-6-carbonyl]amino]hexanoic acid (PubChem CID 90374048) has the molecular formula C29H38N4O5 and a molecular weight of 522.65 g/mol. Its IUPAC name is 6-[[1-acetyl-2-methyl-4-(4-morpholin-4-ylanilino)-3,4-dihydro-2H-quinoline-6-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[1-acetyl-2-methyl-4-(4-morpholin-4-ylanilino)-3,4-dihydro-2H-quinoline-6-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 90374048 |
| Molecular Formula | C29H38N4O5 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 6-[[1-acetyl-2-methyl-4-(4-morpholin-4-ylanilino)-3,4-dihydro-2H-quinoline-6-carbonyl]amino]hexanoic acid |
| SMILES | CC(=O)N1c2ccc(C(=O)NCCCCCC(=O)O)cc2C(Nc2ccc(N3CCOCC3)cc2)CC1C |
| InChI | InChI=1S/C29H38N4O5/c1-20-18-26(31-23-8-10-24(11-9-23)32-14-16-38-17-15-32)25-19-22(7-12-27(25)33(20)21(2)34)29(37)30-13-5-3-4-6-28(35)36/h7-12,19-20,26,31H,3-6,13-18H2,1-2H3,(H,30,37)(H,35,36) |
| InChIKey | DRPXSTWAPYOVOF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|