C12H16ClNO2S — CID 84713685
1-propan-2-yl-3,4-dihydro-2H-quinoline-7-sulfonyl chloride (PubChem CID 84713685) has the molecular formula C12H16ClNO2S and a molecular weight of 273.79 g/mol. Its IUPAC name is 1-propan-2-yl-3,4-dihydro-2H-quinoline-7-sulfonyl chloride.
| Compound Name | 1-propan-2-yl-3,4-dihydro-2H-quinoline-7-sulfonyl chloride |
|---|---|
| PubChem CID | 84713685 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-propan-2-yl-3,4-dihydro-2H-quinoline-7-sulfonyl chloride |
| SMILES | CC(C)N1CCCc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C12H16ClNO2S/c1-9(2)14-7-3-4-10-5-6-11(8-12(10)14)17(13,15)16/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | SNQSVYVWOGDPQG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |