C14H18ClNO4S — CID 131556812
tert-butyl 7-chlorosulfonyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 131556812) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is tert-butyl 7-chlorosulfonyl-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 7-chlorosulfonyl-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 131556812 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | tert-butyl 7-chlorosulfonyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C14H18ClNO4S/c1-14(2,3)20-13(17)16-8-4-5-10-6-7-11(9-12(10)16)21(15,18)19/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | YXZDIGOVYMJGQZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |