C20H21ClN2O4S — CID 158071157
3,4-dihydro-2H-quinoline-1-carbaldehyde;1-formyl-3,4-dihydro-2H-quinoline-6-sulfonyl chloride (PubChem CID 158071157) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinoline-1-carbaldehyde;1-formyl-3,4-dihydro-2H-quinoline-6-sulfonyl chloride.
| Compound Name | 3,4-dihydro-2H-quinoline-1-carbaldehyde;1-formyl-3,4-dihydro-2H-quinoline-6-sulfonyl chloride |
|---|---|
| PubChem CID | 158071157 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 3,4-dihydro-2H-quinoline-1-carbaldehyde;1-formyl-3,4-dihydro-2H-quinoline-6-sulfonyl chloride |
| SMILES | O=CN1CCCc2cc(S(=O)(=O)Cl)ccc21.O=CN1CCCc2ccccc21 |
| InChI | InChI=1S/C10H10ClNO3S.C10H11NO/c11-16(14,15)9-3-4-10-8(6-9)2-1-5-12(10)7-13;12-8-11-7-3-5-9-4-1-2-6-10(9)11/h3-4,6-7H,1-2,5H2;1-2,4,6,8H,3,5,7H2 |
| InChIKey | FLVIXWPFVPZMEY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|