C14H14N2O3S2 — CID 58182290
6-(1,3-thiazol-2-ylmethylsulfonyl)-3,4-dihydro-2H-quinoline-1-carbaldehyde (PubChem CID 58182290) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 6-(1,3-thiazol-2-ylmethylsulfonyl)-3,4-dihydro-2H-quinoline-1-carbaldehyde.
| Compound Name | 6-(1,3-thiazol-2-ylmethylsulfonyl)-3,4-dihydro-2H-quinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 58182290 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 6-(1,3-thiazol-2-ylmethylsulfonyl)-3,4-dihydro-2H-quinoline-1-carbaldehyde |
| SMILES | O=CN1CCCc2cc(S(=O)(=O)Cc3nccs3)ccc21 |
| InChI | InChI=1S/C14H14N2O3S2/c17-10-16-6-1-2-11-8-12(3-4-13(11)16)21(18,19)9-14-15-5-7-20-14/h3-5,7-8,10H,1-2,6,9H2 |
| InChIKey | ZYZUQVDGPRGRTK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|