C22H25N3O3S2 — CID 158199260
N,N,2,6-tetramethyl-4-[7-(1,3-thiazol-2-ylmethylsulfonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]aniline (PubChem CID 158199260) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N,N,2,6-tetramethyl-4-[7-(1,3-thiazol-2-ylmethylsulfonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]aniline.
| Compound Name | N,N,2,6-tetramethyl-4-[7-(1,3-thiazol-2-ylmethylsulfonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]aniline |
|---|---|
| PubChem CID | 158199260 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N,N,2,6-tetramethyl-4-[7-(1,3-thiazol-2-ylmethylsulfonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]aniline |
| SMILES | Cc1cc(N2CCOc3cc(S(=O)(=O)Cc4nccs4)ccc32)cc(C)c1N(C)C |
| InChI | InChI=1S/C22H25N3O3S2/c1-15-11-17(12-16(2)22(15)24(3)4)25-8-9-28-20-13-18(5-6-19(20)25)30(26,27)14-21-23-7-10-29-21/h5-7,10-13H,8-9,14H2,1-4H3 |
| InChIKey | GASPPNKGNUUJOQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|