C19H14FN3O3S2 — CID 159927665
4-(5-fluoro-2-isocyanophenyl)-7-(1,3-thiazol-2-ylmethylsulfonyl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 159927665) has the molecular formula C19H14FN3O3S2 and a molecular weight of 415.47 g/mol. Its IUPAC name is 4-(5-fluoro-2-isocyanophenyl)-7-(1,3-thiazol-2-ylmethylsulfonyl)-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(5-fluoro-2-isocyanophenyl)-7-(1,3-thiazol-2-ylmethylsulfonyl)-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 159927665 |
| Molecular Formula | C19H14FN3O3S2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 4-(5-fluoro-2-isocyanophenyl)-7-(1,3-thiazol-2-ylmethylsulfonyl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | [C-]#[N+]c1ccc(F)cc1N1CCOc2cc(S(=O)(=O)Cc3nccs3)ccc21 |
| InChI | InChI=1S/C19H14FN3O3S2/c1-21-15-4-2-13(20)10-17(15)23-7-8-26-18-11-14(3-5-16(18)23)28(24,25)12-19-22-6-9-27-19/h2-6,9-11H,7-8,12H2 |
| InChIKey | NZFQDEDZDACEAE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|