C13H16ClNO3S — CID 82021448
1-butanoyl-3,4-dihydro-2H-quinoline-6-sulfonyl chloride (PubChem CID 82021448) has the molecular formula C13H16ClNO3S and a molecular weight of 301.80 g/mol. Its IUPAC name is 1-butanoyl-3,4-dihydro-2H-quinoline-6-sulfonyl chloride.
| Compound Name | 1-butanoyl-3,4-dihydro-2H-quinoline-6-sulfonyl chloride |
|---|---|
| PubChem CID | 82021448 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-butanoyl-3,4-dihydro-2H-quinoline-6-sulfonyl chloride |
| SMILES | CCCC(=O)N1CCCc2cc(S(=O)(=O)Cl)ccc21 |
| InChI | InChI=1S/C13H16ClNO3S/c1-2-4-13(16)15-8-3-5-10-9-11(19(14,17)18)6-7-12(10)15/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | YMWFVSMNQOHPKN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |