C19H22N2O — CID 157192076
3,4-dihydro-2H-quinoline-1-carbaldehyde;1,2,3,4-tetrahydroquinoline (PubChem CID 157192076) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinoline-1-carbaldehyde;1,2,3,4-tetrahydroquinoline.
| Compound Name | 3,4-dihydro-2H-quinoline-1-carbaldehyde;1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 157192076 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3,4-dihydro-2H-quinoline-1-carbaldehyde;1,2,3,4-tetrahydroquinoline |
| SMILES | O=CN1CCCc2ccccc21.c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C10H11NO.C9H11N/c12-8-11-7-3-5-9-4-1-2-6-10(9)11;1-2-6-9-8(4-1)5-3-7-10-9/h1-2,4,6,8H,3,5,7H2;1-2,4,6,10H,3,5,7H2 |
| InChIKey | APUVLNYJHDHSFX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|