C21H18N4OS — CID 154585932
4-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)isoquinolin-1-yl]morpholine (PubChem CID 154585932) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is 4-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)isoquinolin-1-yl]morpholine.
| Compound Name | 4-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)isoquinolin-1-yl]morpholine |
|---|---|
| PubChem CID | 154585932 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)isoquinolin-1-yl]morpholine |
| SMILES | c1ccc2c(N3CCOCC3)nc(-c3csc(-c4ccncc4)n3)cc2c1 |
| InChI | InChI=1S/C21H18N4OS/c1-2-4-17-16(3-1)13-18(23-20(17)25-9-11-26-12-10-25)19-14-27-21(24-19)15-5-7-22-8-6-15/h1-8,13-14H,9-12H2 |
| InChIKey | FYAJDJXCWKGART-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |