C16H32AlNO — CID 154587323
(Z)-5-di(propan-2-yl)alumanyloxy-N-propan-2-ylhept-4-en-3-imine (PubChem CID 154587323) has the molecular formula C16H32AlNO and a molecular weight of 281.42 g/mol. Its IUPAC name is (Z)-5-di(propan-2-yl)alumanyloxy-N-propan-2-ylhept-4-en-3-imine.
| Compound Name | (Z)-5-di(propan-2-yl)alumanyloxy-N-propan-2-ylhept-4-en-3-imine |
|---|---|
| PubChem CID | 154587323 |
| Molecular Formula | C16H32AlNO |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | (Z)-5-di(propan-2-yl)alumanyloxy-N-propan-2-ylhept-4-en-3-imine |
| SMILES | CC/C(=C/C(CC)=N/C(C)C)O[Al](C(C)C)C(C)C |
| InChI | InChI=1S/C10H19NO.2C3H7.Al/c1-5-9(11-8(3)4)7-10(12)6-2;2*1-3-2;/h7-8,12H,5-6H2,1-4H3;2*3H,1-2H3;/q;;;+1/p-1/b10-7-,11-9+;;; |
| InChIKey | JJAJPKIUGKXKLF-GNQYZEBUSA-M |
| XLogP | 5.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|