C18H36AlNO — CID 154587305
(Z)-5-di(propan-2-yl)alumanyloxy-2,6-dimethyl-N-propan-2-ylhept-4-en-3-imine (PubChem CID 154587305) has the molecular formula C18H36AlNO and a molecular weight of 309.47 g/mol. Its IUPAC name is (Z)-5-di(propan-2-yl)alumanyloxy-2,6-dimethyl-N-propan-2-ylhept-4-en-3-imine.
| Compound Name | (Z)-5-di(propan-2-yl)alumanyloxy-2,6-dimethyl-N-propan-2-ylhept-4-en-3-imine |
|---|---|
| PubChem CID | 154587305 |
| Molecular Formula | C18H36AlNO |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.26 |
| IUPAC Name | (Z)-5-di(propan-2-yl)alumanyloxy-2,6-dimethyl-N-propan-2-ylhept-4-en-3-imine |
| SMILES | CC(C)/N=C(/C=C(\O[Al](C(C)C)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C12H23NO.2C3H7.Al/c1-8(2)11(13-10(5)6)7-12(14)9(3)4;2*1-3-2;/h7-10,14H,1-6H3;2*3H,1-2H3;/q;;;+1/p-1/b12-7-,13-11-;;; |
| InChIKey | GJRDQCPDTRQESC-VZJFWNHXSA-M |
| XLogP | 5.86 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|