C15H29AlClNO — CID 154587338
(Z)-5-[tert-butyl(chloro)alumanyl]oxy-N-ethyl-2,6-dimethylhept-4-en-3-imine (PubChem CID 154587338) has the molecular formula C15H29AlClNO and a molecular weight of 301.84 g/mol. Its IUPAC name is (Z)-5-[tert-butyl(chloro)alumanyl]oxy-N-ethyl-2,6-dimethylhept-4-en-3-imine.
| Compound Name | (Z)-5-[tert-butyl(chloro)alumanyl]oxy-N-ethyl-2,6-dimethylhept-4-en-3-imine |
|---|---|
| PubChem CID | 154587338 |
| Molecular Formula | C15H29AlClNO |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (Z)-5-[tert-butyl(chloro)alumanyl]oxy-N-ethyl-2,6-dimethylhept-4-en-3-imine |
| SMILES | CC/N=C(/C=C(\O[Al](Cl)C(C)(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C11H21NO.C4H9.Al.ClH/c1-6-12-10(8(2)3)7-11(13)9(4)5;1-4(2)3;;/h7-9,13H,6H2,1-5H3;1-3H3;;1H/q;;+2;/p-2/b11-7-,12-10-;;; |
| InChIKey | KZVZZAXMTRGNOO-PWAPHRHFSA-L |
| XLogP | 5.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|