C6H9N — CID 154588059
5-(trideuteriomethyl)-3,4-dihydropyridine (PubChem CID 154588059) has the molecular formula C6H9N and a molecular weight of 98.16 g/mol. Its IUPAC name is 5-(trideuteriomethyl)-3,4-dihydropyridine.
| Compound Name | 5-(trideuteriomethyl)-3,4-dihydropyridine |
|---|---|
| PubChem CID | 154588059 |
| Molecular Formula | C6H9N |
| Molecular Weight | 98.16 g/mol |
| Exact Mass | 98.09 |
| IUPAC Name | 5-(trideuteriomethyl)-3,4-dihydropyridine |
| SMILES | [2H]C([2H])([2H])C1=CN=CCC1 |
| InChI | InChI=1S/C6H9N/c1-6-3-2-4-7-5-6/h4-5H,2-3H2,1H3/i1D3 |
| InChIKey | RRFBLSWGVSAYSJ-FIBGUPNXSA-N |
| XLogP | 1.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |