C8H13N3O3 — CID 154589259
2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 154589259) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | 2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 154589259 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | NC(=O)N1CCC2(CC1)CNC(=O)O2 |
| InChI | InChI=1S/C8H13N3O3/c9-6(12)11-3-1-8(2-4-11)5-10-7(13)14-8/h1-5H2,(H2,9,12)(H,10,13) |
| InChIKey | YTLBYTGYBVYNDF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |