C14H10ClF2NO — CID 154589457
2-chloro-4-(3,5-difluorophenyl)-3-[(E)-2-methoxyethenyl]pyridine (PubChem CID 154589457) has the molecular formula C14H10ClF2NO and a molecular weight of 281.69 g/mol. Its IUPAC name is 2-chloro-4-(3,5-difluorophenyl)-3-[(E)-2-methoxyethenyl]pyridine.
| Compound Name | 2-chloro-4-(3,5-difluorophenyl)-3-[(E)-2-methoxyethenyl]pyridine |
|---|---|
| PubChem CID | 154589457 |
| Molecular Formula | C14H10ClF2NO |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-chloro-4-(3,5-difluorophenyl)-3-[(E)-2-methoxyethenyl]pyridine |
| SMILES | CO/C=C/c1c(-c2cc(F)cc(F)c2)ccnc1Cl |
| InChI | InChI=1S/C14H10ClF2NO/c1-19-5-3-13-12(2-4-18-14(13)15)9-6-10(16)8-11(17)7-9/h2-8H,1H3/b5-3+ |
| InChIKey | ASZUVKCOXXFPDM-HWKANZROSA-N |
| XLogP | 4.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|