C18H11Cl3FNO — CID 175512944
2,3-dichloro-4-[2-chloro-3-(3-fluoro-5-methoxyphenyl)phenyl]pyridine (PubChem CID 175512944) has the molecular formula C18H11Cl3FNO and a molecular weight of 382.65 g/mol. Its IUPAC name is 2,3-dichloro-4-[2-chloro-3-(3-fluoro-5-methoxyphenyl)phenyl]pyridine.
| Compound Name | 2,3-dichloro-4-[2-chloro-3-(3-fluoro-5-methoxyphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 175512944 |
| Molecular Formula | C18H11Cl3FNO |
| Molecular Weight | 382.65 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 2,3-dichloro-4-[2-chloro-3-(3-fluoro-5-methoxyphenyl)phenyl]pyridine |
| SMILES | COc1cc(F)cc(-c2cccc(-c3ccnc(Cl)c3Cl)c2Cl)c1 |
| InChI | InChI=1S/C18H11Cl3FNO/c1-24-12-8-10(7-11(22)9-12)13-3-2-4-14(16(13)19)15-5-6-23-18(21)17(15)20/h2-9H,1H3 |
| InChIKey | OTHJMXVVPGRMFY-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|