C14H10ClFN2O — CID 172571043
4-chloro-2-(3-fluoro-5-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 172571043) has the molecular formula C14H10ClFN2O and a molecular weight of 276.70 g/mol. Its IUPAC name is 4-chloro-2-(3-fluoro-5-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-chloro-2-(3-fluoro-5-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 172571043 |
| Molecular Formula | C14H10ClFN2O |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 4-chloro-2-(3-fluoro-5-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1cc(F)cc(-c2cc3c(Cl)ccnc3[nH]2)c1 |
| InChI | InChI=1S/C14H10ClFN2O/c1-19-10-5-8(4-9(16)6-10)13-7-11-12(15)2-3-17-14(11)18-13/h2-7H,1H3,(H,17,18) |
| InChIKey | ZJXXQLRUEKNKHG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |