C15H13ClN2O — CID 172570987
4-chloro-2-(2-ethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 172570987) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 4-chloro-2-(2-ethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-chloro-2-(2-ethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 172570987 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 4-chloro-2-(2-ethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCOc1ccccc1-c1cc2c(Cl)ccnc2[nH]1 |
| InChI | InChI=1S/C15H13ClN2O/c1-2-19-14-6-4-3-5-10(14)13-9-11-12(16)7-8-17-15(11)18-13/h3-9H,2H2,1H3,(H,17,18) |
| InChIKey | DQDBSJJLIRSWHZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |