About 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol
3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol (PubChem CID 172570950) has the molecular formula C13H8ClFN2O
and a molecular weight of 262.67 g/mol. Its IUPAC name is 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol.
Molecular Properties
| Compound Name | 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol |
| PubChem CID | 172570950 |
| Molecular Formula | C13H8ClFN2O |
| Molecular Weight | 262.67 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol |
| SMILES | Oc1cc(F)cc(-c2cc3c(Cl)ccnc3[nH]2)c1 |
| InChI | InChI=1S/C13H8ClFN2O/c14-11-1-2-16-13-10(11)6-12(17-13)7-3-8(15)5-9(18)4-7/h1-6,18H,(H,16,17) |
| InChIKey | SUZTVZKHOLMDAP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol?
The IUPAC name of 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol (CID 172570950) is 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol.
What is the SMILES notation for 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol?
The canonical SMILES for 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol is Oc1cc(F)cc(-c2cc3c(Cl)ccnc3[nH]2)c1.
What is the InChIKey of 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol?
The InChIKey is SUZTVZKHOLMDAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClFN2O/c14-11-1-2-16-13-10(11)6-12(17-13)7-3-8(15)5-9(18)4-7/h1-6,18H,(H,16,17).
What are the key properties of 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol?
3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol has a molecular weight of 262.67 g/mol, XLogP of 3.73, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-5-fluorophenol is sourced from PubChem (CID 172570950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).