C19H14N2O — CID 72792825
4-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol (PubChem CID 72792825) has the molecular formula C19H14N2O and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol.
| Compound Name | 4-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol |
|---|---|
| PubChem CID | 72792825 |
| Molecular Formula | C19H14N2O |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenol |
| SMILES | Oc1ccc(-c2cnc3[nH]cc(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C19H14N2O/c22-16-8-6-13(7-9-16)15-10-17-18(12-21-19(17)20-11-15)14-4-2-1-3-5-14/h1-12,22H,(H,20,21) |
| InChIKey | ITYLGQGHVRSNFQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |